ChemNet > CAS > 78-19-3 3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane
78-19-3 3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane
| Nome do produto |
3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane |
| Sinônimos |
3,9-Divinylspirobis(m-dioxan); 3,9-diethenyl-2,4,8,10-tetraoxaspiro[5.5]undecane; 3,9-Divinylspirobi(m-dioxane) |
| Fórmula molecular |
C11H16O4 |
| Peso Molecular |
212.2423 |
| InChI |
InChI=1/C11H16O4/c1-3-9-12-5-11(6-13-9)7-14-10(4-2)15-8-11/h3-4,9-10H,1-2,5-8H2 |
| CAS Registry Number |
78-19-3 |
| EINECS |
201-092-7 |
| Estrutura Molecular |
![78-19-3 3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane](https://images-a.chemnet.com/suppliers/chembase/566/5666.gif)
|
| Densidade |
1.11g/cm3 |
| Ponto de fusão |
43-46℃ |
| Ponto de ebulição |
284.4°C at 760 mmHg |
| índice de refração |
1.493 |
| O ponto de inflamação |
106.6°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
